rev: tip chemfp_examples/ -rw-r--r-- 12.3 KiB View raw Log this file
4cc8c0960796Andrew Dalke looks like I figured out the image links a month ago
# This is an example of using chemfp with Streamlit 
# Given a ChEMBL id or name, or a SMILES string, do a k-nearest
# neighbor search of the ChEMBL fingerprints.
# Put the results in a Pandas table, and use RDKit to depict the
# structures.
# This requires:
#   - RDKit, streamlit, and Pandas
#   - the ChEMBL 28 fingerprints as 'chembl_28.fpb'
#   - the ChEMBL 28 SQLite3 database as 'chembl_28.db'
# For details about getting chembl_28.fpb and chembl_28.db, see:
#    http:///
# If the two data files are in the local directory then
# start streamlit with:
#    streamlit run
# You may configure the fingerprint and sqlite filenames with:
#    streamlit run -- --fingerprints /some/path.fpb --sqlite /some/path.db
# By default, streamlit will start a server and point your browser
# to it, for example, to:

import os
import time
import argparse
import sqlite3
import random
import csv
import base64

import streamlit as st # This program requires the 'streamlit' package
import pandas as pd # This program requires the 'pandas' package
import rdkit # This program requires RDKit; see
from rdkit.Chem import PandasTools

import chemfp # This program requires chemfp; see

# Return the compound report URL for a given ChEMBL id
def get_chembl_url(chembl_id):
    return f"{chembl_id}/"

# Helper function to report an error message and exit.
def die(msg):
    error_line, _, info = msg.partition("\n")
    info = info.strip()
    if info:"\n", "\n\n"))

def get_filename(filename, default_filenames, errmsg):
    if filename is not None:
        return filename
    for filename in default_filenames:
        if os.path.exists(filename):
            return filename

parser = argparse.ArgumentParser(
    description = "Example program using streamlit for a ChEMBL fingerprint similarity search using chemfp.",
    "-f", "--fingerprints", metavar = "FILENAME",
    help = "Location of the FPB file containing ChEMBL fingerprint.",
    "-s", "--sqlite", metavar = "FILENAME",
    help = "Location of 'chembl_28.db' SQLite3 file from the ChEMBL distribution.",
parser.add_argument("--no-mmap", action="store_true")

args = parser.parse_args()

fp_filename = get_filename(
    "Could not find the ChEMBL fingerprints.\n"
    "--fingerprints not specified and FPB file not found in the current directory.\n"
    "Download it from .\n"
    "See for setup details.")

sqlite_filename = get_filename(
    "Could not find the ChEMBL SQLite database.\n"
    "--sqlite not specified and 'chembl_28.db' not found in the current directory.\n"
    "See for setup details.")

# Streamlit re-runs the program after each change.
# While chemfp support compressed FPB files, it takes several seconds
# to decompress and load the file each time, which is too slow for
# reasonable interactive use.
# It's far better to use uncompressed FPB files.
# This load step cannot be cached for several reasons:
#  1) chemfp uses relative imports inside of functions, which streamlit
#    does not support. ( )
#  2) chemfp by default uses a memory-mapped file to read uncompressed
#    FPB files. Streamlit's cache uses Python's pickle, and Python's
#    mmap object cannot by pickled.
#  3) If allow_mmap=False then it can be pickled, but the pickle requires
#    over 2GB, which is far larger than what Streamlit's cache allows,
#    and in any case, pickling/unpickling is far slower than re-opening
#    the memory-mapped file.
t1 = time.time()
    arena = chemfp.load_fingerprints(fp_filename, allow_mmap = not args.no_mmap) # Looking for chemfp_28.fpb
except OSError as err:
    die(f"Cannot open ChEMBL fingerprint file: {err}.\nUse --fingerprints to specify an alternate location.")
except ValueError as err:
    die(f"Unable to open fingerprint file: {err}")
load_time = time.time() - t1

fptype = arena.get_fingerprint_type()

# Connect to the SQLite database.
if not os.path.exists(sqlite_filename):
    die(f"No ChEMBL SQLite file found at {sqlite_filename!r}.\nUse --sqlite to specify an alternate location.")
db = sqlite3.connect(sqlite_filename)
cursor = db.cursor()
version_name, version_comments = cursor.execute("SELECT name, comments FROM version").fetchone()

# Helper function to figure out what the query was and turn it into a SMILES.
def get_query_smiles(cursor, query):
    if query is None:
        return ("default query", "Cn1cnc2c1c(=O)[nH]c(=O)n2C", None)
    if query.startswith("CHEMBL"):
        cursor.execute("SELECT entity_type, entity_id FROM chembl_id_lookup WHERE chembl_id = ?",
        row = cursor.fetchone()
        if row is None:
            return (None, None, "ChEMBL id not found")
        entity_type, entity_id = row
        if entity_type != "COMPOUND":
            return (None, None, f"ChEMBL id entity type is '{entity_type}', expecting 'COMPOUND'")

        molregno = entity_id
        cursor.execute("SELECT canonical_smiles FROM compound_structures WHERE molregno = ?",
        row = cursor.fetchone()
        if row is None:
            return (None, None, "No canonical SMILES available for molregno {molregno}")
        return ("ChEMBL id", row[0], None)

    # See if it's a compound name
SELECT canonical_smiles FROM compound_structures, compound_records
                       WHERE compound_structures.molregno = compound_records.molregno
                         AND compound_name = ?
                     LIMIT 1""", (query,))
    row = cursor.fetchone()
    if row is not None:
        return ("ChEMBL title", row[0], None)

    # Treat it as a SMILES
    return ("query SMILES", query, None)

# Helper function to get a name and the SMILES for an id.
def get_name_and_smiles_for_id(cursor, chembl_id):
SELECT molecule_dictionary.pref_name, compound_records.compound_name, compound_structures.canonical_smiles
         FROM molecule_dictionary, chembl_id_lookup, compound_structures, compound_records
        WHERE chembl_id_lookup.chembl_id = ?
          AND chembl_id_lookup.entity_id = compound_structures.molregno
          AND chembl_id_lookup.entity_id = compound_structures.molregno
          AND chembl_id_lookup.entity_id = molecule_dictionary.molregno
      LIMIT 1""", (chembl_id,))
    row = cursor.fetchone()
    if row is None:
        return None, None
    pref_name, compound_name, smiles = row
    # If there is a preferred name, use it, otherwise use
    # one of the names in the compound records.
    if pref_name is None:
        return compound_name, smiles
    return pref_name, smiles

#### End of setup. Start working with streamlit.

st.title("ChEMBL similarity search with Streamlit, chemfp, RDKit, and Pandas.")

# Set the query entry widget
query = st.sidebar.text_input(
    "ChEMBL id, name or SMILES",
    value = "CHEMBL1114",

# Let the user choose a random id instead.
if st.sidebar.button("Choose a random id"):
    query = random.choice(arena.ids)

# Choose the number of neighbors to find and minimum threshold.
k = st.sidebar.selectbox(
    "k", [1, 5, 10, 25, 50, 100, 250, 500, 1000],
    index = 2)

threshold = st.sidebar.slider(
    "minimum similarity",
    value = 0.4,
    min_value = 0.0, max_value = 1.0,
    step = 0.01)

#### The main section

## Do the k-nearest search

query_placeholder = st.empty()

with query_placeholder:
    st.write(f"Query: {query!r}.")

# Do we already know about the fingerprint?
query_fp = arena.get_fingerprint_by_id(query)
if query_fp is None:
    # What is it?
    query_type, query_smiles, query_errmsg = get_query_smiles(cursor, query)

    if query_errmsg is not None:
        st.warning(f"Unable to use {query!r}: {query_errmsg}")

    # Can we turn it into a fingerprint?
    query_fp = fptype.parse_molecule_fingerprint(query_smiles, "smistring", errors="ignore")
    if query_fp is None:
        if query_type == "query SMILES":
            st.warning(f"Unable to use {query!r}: cannot process it as a SMILES")
            st.warning(f"Unable to use {query!r}: cannot process the SMILES {query_smiles!r}")
    query_type = "fingerprint id"

with query_placeholder:
    st.write(f"Query: {query!r}, interpreted as a {query_type}.")

st.write(f"Similarity search for the k = {k} nearest neighbors with a minimum similarity of {threshold}.")
# This timing measurement includes the time needed to load the
# fingerprints from mass storage into memory, which can vary
# based on how much space is available for your file system cache.
# You can use --no-mmap so all the data is loaded in
# load_fingerprints(), but that will likely reduce the overall
# performance because the k-nearest search might not need to search
# all of the data.

start_time = time.time()
hits = arena.knearest_tanimoto_search_fp(query_fp, k=k, threshold=threshold)
search_time = time.time() - start_time

if args.no_mmap:
    st.write(f"Fingerprint load time: {1000 * load_time:.1f} milliseconds, "
                 f"search time: {1000 * search_time:.1f} milliseconds.")
    st.write(f"Fingerprint load and search time: {1000 * search_time:.1f} milliseconds.")

#### Report the results

st.write(f"Number of hits: {len(hits)}")

chembl_ids = hits.get_ids()

if chembl_ids:
    info_list = [get_name_and_smiles_for_id(cursor, id) for id in chembl_ids]

    # Converts [(name1, smiles1), (name2, smiles2), ... ]
    # into [(name1, name2, ...), (smiles1, smiles2, ...)]
    name_list, smiles_list = list(zip(*info_list))
    name_list = []
    smiles_list = []

results_df = pd.DataFrame({
    "id": chembl_ids,
    "score": hits.get_scores(),
    "name": name_list,
    "smiles": smiles_list,
PandasTools.AddMoleculeColumnToFrame(results_df, "smiles", "molecule")

# Change the ordering of the columns
results_df = results_df[["id", "score", "molecule", "name", "smiles"]]

### Export to SMILES and CSV

smi_content = results_df.to_csv(
    sep = "\t",
    columns = ["smiles", "id"],
    header = False,
    index = False,
    quoting = csv.QUOTE_NONE,
encoded_smi_content = base64.urlsafe_b64encode(smi_content).decode("ascii")

csv_content = results_df.to_csv(
    columns = ["smiles", "id", "name"],
    index = False,
encoded_csv_content = base64.urlsafe_b64encode(csv_content).decode("ascii")

download_links_html = (
    f'Download as: '
    f'<a href="data:text/plain;base64,{encoded_smi_content}">SMILES</a>'
    f' or '
    f'<a href="data:text/plain;base64,{encoded_csv_content}">CSV</a>'

st.write(download_links_html, unsafe_allow_html=True)

### Write the DataFrame

def format_chembl_id(chembl_id):
    return f"<a href='{get_chembl_url(chembl_id)}'>{chembl_id}</a>"

## Add color to the scores.
# Table mapping range to text color and background rgb().
similarity_colors = [
    ("white", (68, 1, 84)),     # 0.0 <= score < 0.1
    ("white", (72, 36, 117)),   # 0.1 <= score < 0.2
    ("white", (65, 67, 135)),   # 0.2 <= score < 0.3
    ("white", (52, 95, 141)),   # 0.3 <= score < 0.4
    ("yellow", (41, 120, 142)), # 0.4 <= score < 0.5
    ("yellow", (32, 145, 140)), # 0.5 <= score < 0.6
    ("yellow", (34, 168, 132)), # 0.6 <= score < 0.7
    ("black", (68, 191, 112)),  # 0.7 <= score < 0.8
    ("black", (122, 210, 81)),  # 0.8 <= score < 0.9
    ("black", (189, 223, 38)),  # 0.9 <= score < 1.0
    ("black", (254, 231, 36)),  # score == 1.0 exactly
similarity_spans = [
    f"<span style='color: {fgcolor}; background-color: rgb({r}, {g}, {b})'>%f</span>"
         for (fgcolor, (r, g, b)) in similarity_colors]

def format_score(score):
    return similarity_spans[int(score * 10)] % (score,)

results_html = results_df.to_html(
    formatters = {
        "id": format_chembl_id,
        "score": format_score,
st.write(results_html, unsafe_allow_html=True)